C23H20N4O2S2 — CID 11385351
15-(4-methylphenyl)sulfonyl-11-thia-4,7,9,15-tetrazapentacyclo[10.9.0.02,10.03,7.016,21]henicosa-1(12),2(10),3,8,16,18,20-heptaene (PubChem CID 11385351) has the molecular formula C23H20N4O2S2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 15-(4-methylphenyl)sulfonyl-11-thia-4,7,9,15-tetrazapentacyclo[10.9.0.02,10.03,7.016,21]henicosa-1(12),2(10),3,8,16,18,20-heptaene.
| Compound Name | 15-(4-methylphenyl)sulfonyl-11-thia-4,7,9,15-tetrazapentacyclo[10.9.0.02,10.03,7.016,21]henicosa-1(12),2(10),3,8,16,18,20-heptaene |
|---|---|
| PubChem CID | 11385351 |
| Molecular Formula | C23H20N4O2S2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 15-(4-methylphenyl)sulfonyl-11-thia-4,7,9,15-tetrazapentacyclo[10.9.0.02,10.03,7.016,21]henicosa-1(12),2(10),3,8,16,18,20-heptaene |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3sc4c(c3-c3ccccc32)C2=NCCN2C=N4)cc1 |
| InChI | InChI=1S/C23H20N4O2S2/c1-15-6-8-16(9-7-15)31(28,29)27-12-10-19-20(17-4-2-3-5-18(17)27)21-22-24-11-13-26(22)14-25-23(21)30-19/h2-9,14H,10-13H2,1H3 |
| InChIKey | LVTILKSEHPGDMU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |