C24H30N2O6S — CID 11385963
methyl 2-ethoxy-3-[4-[3-(6-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoate (PubChem CID 11385963) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is methyl 2-ethoxy-3-[4-[3-(6-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoate.
| Compound Name | methyl 2-ethoxy-3-[4-[3-(6-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoate |
|---|---|
| PubChem CID | 11385963 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | methyl 2-ethoxy-3-[4-[3-(6-methylsulfonyloxyindol-1-yl)propylamino]phenyl]propanoate |
| SMILES | CCOC(Cc1ccc(NCCCn2ccc3ccc(OS(C)(=O)=O)cc32)cc1)C(=O)OC |
| InChI | InChI=1S/C24H30N2O6S/c1-4-31-23(24(27)30-2)16-18-6-9-20(10-7-18)25-13-5-14-26-15-12-19-8-11-21(17-22(19)26)32-33(3,28)29/h6-12,15,17,23,25H,4-5,13-14,16H2,1-3H3 |
| InChIKey | HWPMZMCJRVJIKB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|