C46H33ClN4P2 — CID 11388552
6-chloro-2,4-bis[(triphenyl-λ5-phosphanylidene)amino]quinoline-3-carbonitrile (PubChem CID 11388552) has the molecular formula C46H33ClN4P2 and a molecular weight of 739.20 g/mol. Its IUPAC name is 6-chloro-2,4-bis[(triphenyl-λ5-phosphanylidene)amino]quinoline-3-carbonitrile.
| Compound Name | 6-chloro-2,4-bis[(triphenyl-λ5-phosphanylidene)amino]quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 11388552 |
| Molecular Formula | C46H33ClN4P2 |
| Molecular Weight | 739.20 g/mol |
| Exact Mass | 738.19 |
| IUPAC Name | 6-chloro-2,4-bis[(triphenyl-λ5-phosphanylidene)amino]quinoline-3-carbonitrile |
| SMILES | N#Cc1c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)nc2ccc(Cl)cc2c1N=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C46H33ClN4P2/c47-35-31-32-44-42(33-35)45(50-52(36-19-7-1-8-20-36,37-21-9-2-10-22-37)38-23-11-3-12-24-38)43(34-48)46(49-44)51-53(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41/h1-33H |
| InChIKey | OZODFTJLKAMRIR-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.20 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|