C54H39N5P2 — CID 14221177
2-phenyl-1,3-bis[(triphenyl-lambda5-phosphanylidene)amino]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 14221177) has the molecular formula C54H39N5P2 and a molecular weight of 819.89 g/mol. Its IUPAC name is 2-phenyl-1,3-bis[(triphenyl-lambda5-phosphanylidene)amino]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 2-phenyl-1,3-bis[(triphenyl-lambda5-phosphanylidene)amino]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 14221177 |
| Molecular Formula | C54H39N5P2 |
| Molecular Weight | 819.89 g/mol |
| Exact Mass | 819.27 |
| IUPAC Name | 2-phenyl-1,3-bis[(triphenyl-lambda5-phosphanylidene)amino]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | N#Cc1c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)c(-c2ccccc2)c(N=P(c2ccccc2)(c2ccccc2)c2ccccc2)n2c1nc1ccccc12 |
| InChI | InChI=1S/C54H39N5P2/c55-40-48-52(57-60(42-26-10-2-11-27-42,43-28-12-3-13-29-43)44-30-14-4-15-31-44)51(41-24-8-1-9-25-41)54(59-50-39-23-22-38-49(50)56-53(48)59)58-61(45-32-16-5-17-33-45,46-34-18-6-19-35-46)47-36-20-7-21-37-47/h1-39H |
| InChIKey | ILAFLXSKLFGBAJ-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 65.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 819.89 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|