C10H16O3 — CID 11389785
(2R)-2-[(2S,3S)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]propanal (PubChem CID 11389785) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (2R)-2-[(2S,3S)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]propanal.
| Compound Name | (2R)-2-[(2S,3S)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]propanal |
|---|---|
| PubChem CID | 11389785 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | (2R)-2-[(2S,3S)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]propanal |
| SMILES | COC1C=C[C@H](C)[C@@H]([C@@H](C)C=O)O1 |
| InChI | InChI=1S/C10H16O3/c1-7-4-5-9(12-3)13-10(7)8(2)6-11/h4-10H,1-3H3/t7-,8-,9?,10-/m0/s1 |
| InChIKey | TWJBLAVMXXEJLU-HQRIKABESA-N |
| XLogP | 1.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|