C10H15FO2 — CID 11389825
trans-(2S,5R)-2-fluoro-2-methyl-5-(2-methyloxiran-2-yl)cyclohexan-1-one (PubChem CID 11389825) has the molecular formula C10H15FO2 and a molecular weight of 186.23 g/mol. Its IUPAC name is trans-(2S,5R)-2-fluoro-2-methyl-5-(2-methyloxiran-2-yl)cyclohexan-1-one.
| Compound Name | trans-(2S,5R)-2-fluoro-2-methyl-5-(2-methyloxiran-2-yl)cyclohexan-1-one |
|---|---|
| PubChem CID | 11389825 |
| Molecular Formula | C10H15FO2 |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | trans-(2S,5R)-2-fluoro-2-methyl-5-(2-methyloxiran-2-yl)cyclohexan-1-one |
| SMILES | CC1([C@@H]2CC[C@](C)(F)C(=O)C2)CO1 |
| InChI | InChI=1S/C10H15FO2/c1-9(11)4-3-7(5-8(9)12)10(2)6-13-10/h7H,3-6H2,1-2H3/t7-,9+,10?/m1/s1 |
| InChIKey | YZYVBHYMHIXDGK-IKZKJGMZSA-N |
| XLogP | 1.87 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|