About 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol
4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol (PubChem CID 11389866) has the molecular formula C9H20O2Si
and a molecular weight of 188.34 g/mol. Its IUPAC name is 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol.
Molecular Properties
| Compound Name | 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol |
| PubChem CID | 11389866 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol |
| SMILES | C[Si](C)(C)[C@@H]1O[C@@H]1CCCCO |
| InChI | InChI=1S/C9H20O2Si/c1-12(2,3)9-8(11-9)6-4-5-7-10/h8-10H,4-7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | KEPDYGSSVHOYLQ-BDAKNGLRSA-N |
| XLogP | 1.79 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol?
The IUPAC name of 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol (CID 11389866) is 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol.
What is the SMILES notation for 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol?
The canonical SMILES for 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol is C[Si](C)(C)[C@@H]1O[C@@H]1CCCCO.
What is the InChIKey of 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol?
The InChIKey is KEPDYGSSVHOYLQ-BDAKNGLRSA-N. The full InChI is InChI=1S/C9H20O2Si/c1-12(2,3)9-8(11-9)6-4-5-7-10/h8-10H,4-7H2,1-3H3/t8-,9+/m1/s1.
What are the key properties of 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol?
4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol has a molecular weight of 188.34 g/mol, XLogP of 1.79, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,3S)-3-trimethylsilyloxiran-2-yl]butan-1-ol is sourced from PubChem (CID 11389866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).