C8H9N3O2S — CID 11390201
1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione (PubChem CID 11390201) has the molecular formula C8H9N3O2S and a molecular weight of 211.25 g/mol. Its IUPAC name is 1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11390201 |
| Molecular Formula | C8H9N3O2S |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 1-(5-ethyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,5-dione |
| SMILES | CCc1nnc(N2C(=O)CCC2=O)s1 |
| InChI | InChI=1S/C8H9N3O2S/c1-2-5-9-10-8(14-5)11-6(12)3-4-7(11)13/h2-4H2,1H3 |
| InChIKey | YRHGZXDLYOYDHX-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|