C16H23NO — CID 11390924
N-hepta-1,6-dien-4-yl-N-(4-methylpent-2-ynyl)prop-2-enamide (PubChem CID 11390924) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N-hepta-1,6-dien-4-yl-N-(4-methylpent-2-ynyl)prop-2-enamide.
| Compound Name | N-hepta-1,6-dien-4-yl-N-(4-methylpent-2-ynyl)prop-2-enamide |
|---|---|
| PubChem CID | 11390924 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-hepta-1,6-dien-4-yl-N-(4-methylpent-2-ynyl)prop-2-enamide |
| SMILES | C=CCC(CC=C)N(CC#CC(C)C)C(=O)C=C |
| InChI | InChI=1S/C16H23NO/c1-6-10-15(11-7-2)17(16(18)8-3)13-9-12-14(4)5/h6-8,14-15H,1-3,10-11,13H2,4-5H3 |
| InChIKey | SBPAZBXLLWLYPO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|