C13H14N2OS — CID 11390945
4-(2,2-dimethylpropoxy)-1,3-benzothiazole-2-carbonitrile (PubChem CID 11390945) has the molecular formula C13H14N2OS and a molecular weight of 246.33 g/mol. Its IUPAC name is 4-(2,2-dimethylpropoxy)-1,3-benzothiazole-2-carbonitrile.
| Compound Name | 4-(2,2-dimethylpropoxy)-1,3-benzothiazole-2-carbonitrile |
|---|---|
| PubChem CID | 11390945 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 4-(2,2-dimethylpropoxy)-1,3-benzothiazole-2-carbonitrile |
| SMILES | CC(C)(C)COc1cccc2sc(C#N)nc12 |
| InChI | InChI=1S/C13H14N2OS/c1-13(2,3)8-16-9-5-4-6-10-12(9)15-11(7-14)17-10/h4-6H,8H2,1-3H3 |
| InChIKey | RDSZSYCGTJLVHW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |