C16H29NO3 — CID 11391949
tert-butyl N-[(3S,4S,5S)-4-ethynyl-5-hydroxy-2,6-dimethylheptan-3-yl]carbamate (PubChem CID 11391949) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is tert-butyl N-[(3S,4S,5S)-4-ethynyl-5-hydroxy-2,6-dimethylheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4S,5S)-4-ethynyl-5-hydroxy-2,6-dimethylheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 11391949 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | tert-butyl N-[(3S,4S,5S)-4-ethynyl-5-hydroxy-2,6-dimethylheptan-3-yl]carbamate |
| SMILES | C#C[C@H]([C@@H](O)C(C)C)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C16H29NO3/c1-9-12(14(18)11(4)5)13(10(2)3)17-15(19)20-16(6,7)8/h1,10-14,18H,2-8H3,(H,17,19)/t12-,13-,14-/m0/s1 |
| InChIKey | SONXEPJODJXZNR-IHRRRGAJSA-N |
| XLogP | 2.80 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|