C16H22O5S — CID 11393236
2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 11393236) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is 2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11393236 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 2-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@H]1CCOS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H22O5S/c1-5-14-15(21-16(3,4)20-14)10-11-19-22(17,18)13-8-6-12(2)7-9-13/h5-9,14-15H,1,10-11H2,2-4H3/t14-,15-/m0/s1 |
| InChIKey | FIAWCKXTHUQFKJ-GJZGRUSLSA-N |
| XLogP | 2.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|