C22H29NO2 — CID 11393628
N-[(2-but-3-en-2-yl-4-methoxy-3-propan-2-yloxyphenyl)methyl]-1-phenylmethanamine (PubChem CID 11393628) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[(2-but-3-en-2-yl-4-methoxy-3-propan-2-yloxyphenyl)methyl]-1-phenylmethanamine.
| Compound Name | N-[(2-but-3-en-2-yl-4-methoxy-3-propan-2-yloxyphenyl)methyl]-1-phenylmethanamine |
|---|---|
| PubChem CID | 11393628 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | N-[(2-but-3-en-2-yl-4-methoxy-3-propan-2-yloxyphenyl)methyl]-1-phenylmethanamine |
| SMILES | C=CC(C)c1c(CNCc2ccccc2)ccc(OC)c1OC(C)C |
| InChI | InChI=1S/C22H29NO2/c1-6-17(4)21-19(15-23-14-18-10-8-7-9-11-18)12-13-20(24-5)22(21)25-16(2)3/h6-13,16-17,23H,1,14-15H2,2-5H3 |
| InChIKey | BEUCVEHCPJUYRH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|