C20H40O4Si — CID 11394679
ethyl (E,2S,5S,6R)-5-hydroxy-2,6-dimethyl-7-tri(propan-2-yl)silyloxyhept-3-enoate (PubChem CID 11394679) has the molecular formula C20H40O4Si and a molecular weight of 372.62 g/mol. Its IUPAC name is ethyl (E,2S,5S,6R)-5-hydroxy-2,6-dimethyl-7-tri(propan-2-yl)silyloxyhept-3-enoate.
| Compound Name | ethyl (E,2S,5S,6R)-5-hydroxy-2,6-dimethyl-7-tri(propan-2-yl)silyloxyhept-3-enoate |
|---|---|
| PubChem CID | 11394679 |
| Molecular Formula | C20H40O4Si |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | ethyl (E,2S,5S,6R)-5-hydroxy-2,6-dimethyl-7-tri(propan-2-yl)silyloxyhept-3-enoate |
| SMILES | CCOC(=O)[C@@H](C)/C=C/[C@H](O)[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H40O4Si/c1-10-23-20(22)17(8)11-12-19(21)18(9)13-24-25(14(2)3,15(4)5)16(6)7/h11-12,14-19,21H,10,13H2,1-9H3/b12-11+/t17-,18+,19-/m0/s1 |
| InChIKey | JBWSVBXDHMVRFJ-BGQADETBSA-N |
| XLogP | 4.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|