C22H41FO4Si — CID 88956753
[(3Z,5S,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-hydroxy-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate (PubChem CID 88956753) has the molecular formula C22H41FO4Si and a molecular weight of 416.65 g/mol. Its IUPAC name is [(3Z,5S,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-hydroxy-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate.
| Compound Name | [(3Z,5S,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-hydroxy-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 88956753 |
| Molecular Formula | C22H41FO4Si |
| Molecular Weight | 416.65 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | [(3Z,5S,6E,8R,9R)-9-[tert-butyl(dimethyl)silyl]oxy-6-fluoro-5-hydroxy-8-methyldeca-3,6-dienyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](/C=C(/F)[C@@H](O)/C=C\CCOC(=O)C(C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H41FO4Si/c1-16(17(2)27-28(9,10)22(6,7)8)15-18(23)19(24)13-11-12-14-26-20(25)21(3,4)5/h11,13,15-17,19,24H,12,14H2,1-10H3/b13-11-,18-15+/t16-,17-,19+/m1/s1 |
| InChIKey | LVAIIRCBXXJFPY-VFVVVFHCSA-N |
| XLogP | 5.78 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|