C24H48O4Si2 — CID 10837541
2-trimethylsilylethyl (2E,4S,5S,6E)-8-hydroxy-4-methyl-5-tri(propan-2-yl)silyloxynona-2,6-dienoate (PubChem CID 10837541) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,4S,5S,6E)-8-hydroxy-4-methyl-5-tri(propan-2-yl)silyloxynona-2,6-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,4S,5S,6E)-8-hydroxy-4-methyl-5-tri(propan-2-yl)silyloxynona-2,6-dienoate |
|---|---|
| PubChem CID | 10837541 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | 2-trimethylsilylethyl (2E,4S,5S,6E)-8-hydroxy-4-methyl-5-tri(propan-2-yl)silyloxynona-2,6-dienoate |
| SMILES | CC(O)/C=C/[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)/C=C/C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C24H48O4Si2/c1-18(2)30(19(3)4,20(5)6)28-23(14-13-22(8)25)21(7)12-15-24(26)27-16-17-29(9,10)11/h12-15,18-23,25H,16-17H2,1-11H3/b14-13+,15-12+/t21-,22?,23-/m0/s1 |
| InChIKey | AHWWZRBKBVJHHD-MRROMYHDSA-N |
| XLogP | 6.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|