C21H15B3O12S3 — CID 11399146
[5-[3,5-bis[(5-boronothiophene-2-carbonyl)oxy]phenoxy]carbonylthiophen-2-yl]boronic acid (PubChem CID 11399146) has the molecular formula C21H15B3O12S3 and a molecular weight of 587.98 g/mol. Its IUPAC name is [5-[3,5-bis[(5-boronothiophene-2-carbonyl)oxy]phenoxy]carbonylthiophen-2-yl]boronic acid.
| Compound Name | [5-[3,5-bis[(5-boronothiophene-2-carbonyl)oxy]phenoxy]carbonylthiophen-2-yl]boronic acid |
|---|---|
| PubChem CID | 11399146 |
| Molecular Formula | C21H15B3O12S3 |
| Molecular Weight | 587.98 g/mol |
| Exact Mass | 588.00 |
| IUPAC Name | [5-[3,5-bis[(5-boronothiophene-2-carbonyl)oxy]phenoxy]carbonylthiophen-2-yl]boronic acid |
| SMILES | O=C(Oc1cc(OC(=O)c2ccc(B(O)O)s2)cc(OC(=O)c2ccc(B(O)O)s2)c1)c1ccc(B(O)O)s1 |
| InChI | InChI=1S/C21H15B3O12S3/c25-19(13-1-4-16(37-13)22(28)29)34-10-7-11(35-20(26)14-2-5-17(38-14)23(30)31)9-12(8-10)36-21(27)15-3-6-18(39-15)24(32)33/h1-9,28-33H |
| InChIKey | LUJGKIWEXRIZEZ-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 200.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.98 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|