About magnesium;2-methylpropan-2-olate;prop-1-ene
magnesium;2-methylpropan-2-olate;prop-1-ene (PubChem CID 11400811) has the molecular formula C7H14MgO
and a molecular weight of 138.49 g/mol. Its IUPAC name is magnesium;2-methylpropan-2-olate;prop-1-ene.
Molecular Properties
| Compound Name | magnesium;2-methylpropan-2-olate;prop-1-ene |
| PubChem CID | 11400811 |
| Molecular Formula | C7H14MgO |
| Molecular Weight | 138.49 g/mol |
| Exact Mass | 138.09 |
| IUPAC Name | magnesium;2-methylpropan-2-olate;prop-1-ene |
| SMILES | C=[C-]C.CC(C)(C)[O-].[Mg+2] |
| InChI | InChI=1S/C4H9O.C3H5.Mg/c1-4(2,3)5;1-3-2;/h1-3H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | UENQAISFXTWROK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;2-methylpropan-2-olate;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;2-methylpropan-2-olate;prop-1-ene?
The IUPAC name of magnesium;2-methylpropan-2-olate;prop-1-ene (CID 11400811) is magnesium;2-methylpropan-2-olate;prop-1-ene.
What is the SMILES notation for magnesium;2-methylpropan-2-olate;prop-1-ene?
The canonical SMILES for magnesium;2-methylpropan-2-olate;prop-1-ene is C=[C-]C.CC(C)(C)[O-].[Mg+2].
What is the InChIKey of magnesium;2-methylpropan-2-olate;prop-1-ene?
The InChIKey is UENQAISFXTWROK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9O.C3H5.Mg/c1-4(2,3)5;1-3-2;/h1-3H3;1H2,2H3;/q2*-1;+2.
What are the key properties of magnesium;2-methylpropan-2-olate;prop-1-ene?
magnesium;2-methylpropan-2-olate;prop-1-ene has a molecular weight of 138.49 g/mol, XLogP of 0.76, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;2-methylpropan-2-olate;prop-1-ene is sourced from PubChem (CID 11400811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).