About N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide
N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide (PubChem CID 114009702) has the molecular formula C11H11N3O3
and a molecular weight of 233.23 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide.
Molecular Properties
| Compound Name | N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide |
| PubChem CID | 114009702 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide |
| SMILES | N#CCNC(=O)C(=O)NCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H11N3O3/c12-5-6-13-10(16)11(17)14-7-8-1-3-9(15)4-2-8/h1-4,15H,6-7H2,(H,13,16)(H,14,17) |
| InChIKey | JQUBWBRTAPPJDT-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide?
The IUPAC name of N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide (CID 114009702) is N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide.
What is the SMILES notation for N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide?
The canonical SMILES for N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide is N#CCNC(=O)C(=O)NCc1ccc(O)cc1.
What is the InChIKey of N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide?
The InChIKey is JQUBWBRTAPPJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O3/c12-5-6-13-10(16)11(17)14-7-8-1-3-9(15)4-2-8/h1-4,15H,6-7H2,(H,13,16)(H,14,17).
What are the key properties of N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide?
N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide has a molecular weight of 233.23 g/mol, XLogP of -0.35, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(cyanomethyl)-N'-[(4-hydroxyphenyl)methyl]oxamide is sourced from PubChem (CID 114009702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).