C8H8N4O2S — CID 63824471
N-(cyanomethyl)-N'-(1,3-thiazol-4-ylmethyl)oxamide (PubChem CID 63824471) has the molecular formula C8H8N4O2S and a molecular weight of 224.24 g/mol. Its IUPAC name is N-(cyanomethyl)-N'-(1,3-thiazol-4-ylmethyl)oxamide.
| Compound Name | N-(cyanomethyl)-N'-(1,3-thiazol-4-ylmethyl)oxamide |
|---|---|
| PubChem CID | 63824471 |
| Molecular Formula | C8H8N4O2S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | N-(cyanomethyl)-N'-(1,3-thiazol-4-ylmethyl)oxamide |
| SMILES | N#CCNC(=O)C(=O)NCc1cscn1 |
| InChI | InChI=1S/C8H8N4O2S/c9-1-2-10-7(13)8(14)11-3-6-4-15-5-12-6/h4-5H,2-3H2,(H,10,13)(H,11,14) |
| InChIKey | WNRWMAPCURSLFL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|