C12H8F3NS — CID 114016042
4-cyclopropyl-2-(2,4,6-trifluorophenyl)-1,3-thiazole (PubChem CID 114016042) has the molecular formula C12H8F3NS and a molecular weight of 255.26 g/mol. Its IUPAC name is 4-cyclopropyl-2-(2,4,6-trifluorophenyl)-1,3-thiazole.
| Compound Name | 4-cyclopropyl-2-(2,4,6-trifluorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 114016042 |
| Molecular Formula | C12H8F3NS |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-cyclopropyl-2-(2,4,6-trifluorophenyl)-1,3-thiazole |
| SMILES | Fc1cc(F)c(-c2nc(C3CC3)cs2)c(F)c1 |
| InChI | InChI=1S/C12H8F3NS/c13-7-3-8(14)11(9(15)4-7)12-16-10(5-17-12)6-1-2-6/h3-6H,1-2H2 |
| InChIKey | NMHXHEUPWXDURF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |