C12H13N3O2S — CID 114022683
1-(2,5-dimethyl-1,3-thiazol-4-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione (PubChem CID 114022683) has the molecular formula C12H13N3O2S and a molecular weight of 263.32 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-thiazol-4-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione.
| Compound Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione |
|---|---|
| PubChem CID | 114022683 |
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-3-(1-methylimidazol-4-yl)propane-1,3-dione |
| SMILES | Cc1nc(C(=O)CC(=O)c2cn(C)cn2)c(C)s1 |
| InChI | InChI=1S/C12H13N3O2S/c1-7-12(14-8(2)18-7)11(17)4-10(16)9-5-15(3)6-13-9/h5-6H,4H2,1-3H3 |
| InChIKey | UCWHOJXWGFIXMS-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|