C12H17NO2S — CID 63752750
1-(2,5-dimethyl-1,3-thiazol-4-yl)-4,4-dimethylpentane-1,3-dione (PubChem CID 63752750) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1,3-thiazol-4-yl)-4,4-dimethylpentane-1,3-dione.
| Compound Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-4,4-dimethylpentane-1,3-dione |
|---|---|
| PubChem CID | 63752750 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 1-(2,5-dimethyl-1,3-thiazol-4-yl)-4,4-dimethylpentane-1,3-dione |
| SMILES | Cc1nc(C(=O)CC(=O)C(C)(C)C)c(C)s1 |
| InChI | InChI=1S/C12H17NO2S/c1-7-11(13-8(2)16-7)9(14)6-10(15)12(3,4)5/h6H2,1-5H3 |
| InChIKey | NBGUAZVSYUAMEV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|