C15H23BrClN — CID 114027172
1-(2-bromo-5-chlorophenyl)-N,3-diethylpentan-1-amine (PubChem CID 114027172) has the molecular formula C15H23BrClN and a molecular weight of 332.71 g/mol. Its IUPAC name is 1-(2-bromo-5-chlorophenyl)-N,3-diethylpentan-1-amine.
| Compound Name | 1-(2-bromo-5-chlorophenyl)-N,3-diethylpentan-1-amine |
|---|---|
| PubChem CID | 114027172 |
| Molecular Formula | C15H23BrClN |
| Molecular Weight | 332.71 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | 1-(2-bromo-5-chlorophenyl)-N,3-diethylpentan-1-amine |
| SMILES | CCNC(CC(CC)CC)c1cc(Cl)ccc1Br |
| InChI | InChI=1S/C15H23BrClN/c1-4-11(5-2)9-15(18-6-3)13-10-12(17)7-8-14(13)16/h7-8,10-11,15,18H,4-6,9H2,1-3H3 |
| InChIKey | NVESCUSVJWUFJP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |