C13H15FINO — CID 114030282
1-(3,4-dihydro-2H-pyran-6-yl)-1-(4-fluoro-2-iodophenyl)-N-methylmethanamine (PubChem CID 114030282) has the molecular formula C13H15FINO and a molecular weight of 347.17 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-pyran-6-yl)-1-(4-fluoro-2-iodophenyl)-N-methylmethanamine.
| Compound Name | 1-(3,4-dihydro-2H-pyran-6-yl)-1-(4-fluoro-2-iodophenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 114030282 |
| Molecular Formula | C13H15FINO |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 1-(3,4-dihydro-2H-pyran-6-yl)-1-(4-fluoro-2-iodophenyl)-N-methylmethanamine |
| SMILES | CNC(C1=CCCCO1)c1ccc(F)cc1I |
| InChI | InChI=1S/C13H15FINO/c1-16-13(12-4-2-3-7-17-12)10-6-5-9(14)8-11(10)15/h4-6,8,13,16H,2-3,7H2,1H3 |
| InChIKey | SJPFXIUJNWSFNX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|