C15H14O5 — CID 11403079
(1R,5S,8S)-8-(7-methoxy-1,3-benzodioxol-5-yl)-6-oxabicyclo[3.2.1]oct-3-en-7-one (PubChem CID 11403079) has the molecular formula C15H14O5 and a molecular weight of 274.27 g/mol. Its IUPAC name is (1R,5S,8S)-8-(7-methoxy-1,3-benzodioxol-5-yl)-6-oxabicyclo[3.2.1]oct-3-en-7-one.
| Compound Name | (1R,5S,8S)-8-(7-methoxy-1,3-benzodioxol-5-yl)-6-oxabicyclo[3.2.1]oct-3-en-7-one |
|---|---|
| PubChem CID | 11403079 |
| Molecular Formula | C15H14O5 |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | (1R,5S,8S)-8-(7-methoxy-1,3-benzodioxol-5-yl)-6-oxabicyclo[3.2.1]oct-3-en-7-one |
| SMILES | COc1cc([C@H]2[C@@H]3C=CC[C@H]2C(=O)O3)cc2c1OCO2 |
| InChI | InChI=1S/C15H14O5/c1-17-11-5-8(6-12-14(11)19-7-18-12)13-9-3-2-4-10(13)20-15(9)16/h2,4-6,9-10,13H,3,7H2,1H3/t9-,10+,13-/m1/s1 |
| InChIKey | DFMLDHMLFIOQHT-GBIKHYSHSA-N |
| XLogP | 2.01 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|