C14H16O6 — CID 11844270
(1R,2R,3S,6S)-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohex-4-ene-1,2,3-triol (PubChem CID 11844270) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1R,2R,3S,6S)-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohex-4-ene-1,2,3-triol.
| Compound Name | (1R,2R,3S,6S)-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 11844270 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1R,2R,3S,6S)-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohex-4-ene-1,2,3-triol |
| SMILES | COc1cc([C@@H]2C=C[C@H](O)[C@@H](O)[C@@H]2O)cc2c1OCO2 |
| InChI | InChI=1S/C14H16O6/c1-18-10-4-7(5-11-14(10)20-6-19-11)8-2-3-9(15)13(17)12(8)16/h2-5,8-9,12-13,15-17H,6H2,1H3/t8-,9-,12+,13+/m0/s1 |
| InChIKey | ZEOWLZGLYOWMRF-RBJBARPLSA-N |
| XLogP | 0.16 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|