C19H27NO8 — CID 71469342
tert-butyl N-[(1R,2S,3R,4S,6R)-2,3,4-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexyl]carbamate (PubChem CID 71469342) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3R,4S,6R)-2,3,4-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3R,4S,6R)-2,3,4-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexyl]carbamate |
|---|---|
| PubChem CID | 71469342 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | tert-butyl N-[(1R,2S,3R,4S,6R)-2,3,4-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexyl]carbamate |
| SMILES | COc1cc([C@H]2C[C@H](O)[C@@H](O)[C@@H](O)[C@@H]2NC(=O)OC(C)(C)C)cc2c1OCO2 |
| InChI | InChI=1S/C19H27NO8/c1-19(2,3)28-18(24)20-14-10(7-11(21)15(22)16(14)23)9-5-12(25-4)17-13(6-9)26-8-27-17/h5-6,10-11,14-16,21-23H,7-8H2,1-4H3,(H,20,24)/t10-,11+,14-,15-,16+/m1/s1 |
| InChIKey | PGPSBJJRHRGFBG-MOEWQIFZSA-N |
| XLogP | 0.89 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |