C20H27NO5 — CID 70082533
(2S)-2-(2,2-dimethylpent-3-enyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid (PubChem CID 70082533) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is (2S)-2-(2,2-dimethylpent-3-enyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | (2S)-2-(2,2-dimethylpent-3-enyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70082533 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | (2S)-2-(2,2-dimethylpent-3-enyl)-4-(7-methoxy-1,3-benzodioxol-5-yl)pyrrolidine-3-carboxylic acid |
| SMILES | CC=CC(C)(C)C[C@@H]1NCC(c2cc(OC)c3c(c2)OCO3)C1C(=O)O |
| InChI | InChI=1S/C20H27NO5/c1-5-6-20(2,3)9-14-17(19(22)23)13(10-21-14)12-7-15(24-4)18-16(8-12)25-11-26-18/h5-8,13-14,17,21H,9-11H2,1-4H3,(H,22,23)/t13?,14-,17?/m0/s1 |
| InChIKey | JQDLOLXTHHUVEC-UUCFBXCCSA-N |
| XLogP | 3.17 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|