C19H25NO8 — CID 71469341
tert-butyl N-[(1R,2S,3S,6R)-2,3-dihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)-4-oxocyclohexyl]carbamate (PubChem CID 71469341) has the molecular formula C19H25NO8 and a molecular weight of 395.41 g/mol. Its IUPAC name is tert-butyl N-[(1R,2S,3S,6R)-2,3-dihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)-4-oxocyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1R,2S,3S,6R)-2,3-dihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)-4-oxocyclohexyl]carbamate |
|---|---|
| PubChem CID | 71469341 |
| Molecular Formula | C19H25NO8 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | tert-butyl N-[(1R,2S,3S,6R)-2,3-dihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)-4-oxocyclohexyl]carbamate |
| SMILES | COc1cc([C@H]2CC(=O)[C@@H](O)[C@@H](O)[C@@H]2NC(=O)OC(C)(C)C)cc2c1OCO2 |
| InChI | InChI=1S/C19H25NO8/c1-19(2,3)28-18(24)20-14-10(7-11(21)15(22)16(14)23)9-5-12(25-4)17-13(6-9)26-8-27-17/h5-6,10,14-16,22-23H,7-8H2,1-4H3,(H,20,24)/t10-,14-,15-,16+/m1/s1 |
| InChIKey | GITNVNMQNJFOPG-KCXZSRPNSA-N |
| XLogP | 1.10 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |