C21H29NO4 — CID 10546391
ethyl (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]pyrrolidine-3-carboxylate (PubChem CID 10546391) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is ethyl (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]pyrrolidine-3-carboxylate.
| Compound Name | ethyl (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 10546391 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | ethyl (2S,3R,4S)-4-(1,3-benzodioxol-5-yl)-2-[(E)-2,2-dimethylpent-3-enyl]pyrrolidine-3-carboxylate |
| SMILES | C/C=C/C(C)(C)C[C@@H]1NC[C@H](c2ccc3c(c2)OCO3)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C21H29NO4/c1-5-9-21(3,4)11-16-19(20(23)24-6-2)15(12-22-16)14-7-8-17-18(10-14)26-13-25-17/h5,7-10,15-16,19,22H,6,11-13H2,1-4H3/b9-5+/t15-,16+,19-/m1/s1 |
| InChIKey | HLZUVXKYGKZCPH-SCKUNDQRSA-N |
| XLogP | 3.64 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|