C19H20N2O4 — CID 25017154
(1S,4S,5R)-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-(pyridin-2-ylamino)cyclohex-2-en-1-ol (PubChem CID 25017154) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1S,4S,5R)-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-(pyridin-2-ylamino)cyclohex-2-en-1-ol.
| Compound Name | (1S,4S,5R)-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-(pyridin-2-ylamino)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 25017154 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (1S,4S,5R)-5-(7-methoxy-1,3-benzodioxol-5-yl)-4-(pyridin-2-ylamino)cyclohex-2-en-1-ol |
| SMILES | COc1cc([C@H]2C[C@H](O)C=C[C@@H]2Nc2ccccn2)cc2c1OCO2 |
| InChI | InChI=1S/C19H20N2O4/c1-23-16-8-12(9-17-19(16)25-11-24-17)14-10-13(22)5-6-15(14)21-18-4-2-3-7-20-18/h2-9,13-15,22H,10-11H2,1H3,(H,20,21)/t13-,14-,15+/m1/s1 |
| InChIKey | VQGOOWIISALTTJ-KFWWJZLASA-N |
| XLogP | 2.70 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|