C32H38O9Si — CID 72793266
methyl (1R,2S,3S,4S,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3,5-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylate (PubChem CID 72793266) has the molecular formula C32H38O9Si and a molecular weight of 594.73 g/mol. Its IUPAC name is methyl (1R,2S,3S,4S,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3,5-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylate.
| Compound Name | methyl (1R,2S,3S,4S,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3,5-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 72793266 |
| Molecular Formula | C32H38O9Si |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | methyl (1R,2S,3S,4S,5S,6S)-4-[tert-butyl(diphenyl)silyl]oxy-2,3,5-trihydroxy-6-(7-methoxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](O)[C@H](O)[C@@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](O)[C@@H]1c1cc(OC)c2c(c1)OCO2 |
| InChI | InChI=1S/C32H38O9Si/c1-32(2,3)42(20-12-8-6-9-13-20,21-14-10-7-11-15-21)41-30-27(34)24(25(31(36)38-5)26(33)28(30)35)19-16-22(37-4)29-23(17-19)39-18-40-29/h6-17,24-28,30,33-35H,18H2,1-5H3/t24-,25-,26+,27+,28+,30+/m1/s1 |
| InChIKey | VYYVTIPZDOCPLH-NVVUKXAMSA-N |
| XLogP | 2.34 |
| TPSA | 123.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|