2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid

C13H12N2O3S — CID 114030951

IUPAC2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid
SMILESCc1cc(NC(=O)c2cncs2)cc(C(=O)O)c1C
InChIInChI=1S/C13H12N2O3S/c1-7-3-9(4-10(8(7)2)13(17)18)15-12(16)11-5-14-6-19-11/h3-6H,1-2H3,(H,15,16)(H,17,18)
InChIKeyTWBUNKFZWXIWOS-UHFFFAOYSA-N
MW276.32 g/mol
LogP2.71
Rot. Bonds3

About 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid

2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid (PubChem CID 114030951) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid.

Molecular Properties

Compound Name2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid
PubChem CID114030951
Molecular FormulaC13H12N2O3S
Molecular Weight276.32 g/mol
Exact Mass276.06
IUPAC Name2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid
SMILESCc1cc(NC(=O)c2cncs2)cc(C(=O)O)c1C
InChIInChI=1S/C13H12N2O3S/c1-7-3-9(4-10(8(7)2)13(17)18)15-12(16)11-5-14-6-19-11/h3-6H,1-2H3,(H,15,16)(H,17,18)
InChIKeyTWBUNKFZWXIWOS-UHFFFAOYSA-N
XLogP2.71
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.32
LogP ≤ 52.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid?
The IUPAC name of 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid (CID 114030951) is 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid.
What is the SMILES notation for 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid?
The canonical SMILES for 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid is Cc1cc(NC(=O)c2cncs2)cc(C(=O)O)c1C.
What is the InChIKey of 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid?
The InChIKey is TWBUNKFZWXIWOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3S/c1-7-3-9(4-10(8(7)2)13(17)18)15-12(16)11-5-14-6-19-11/h3-6H,1-2H3,(H,15,16)(H,17,18).
What are the key properties of 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid?
2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid has a molecular weight of 276.32 g/mol, XLogP of 2.71, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid is sourced from PubChem (CID 114030951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).