C13H12N2O3S — CID 114030951
2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid (PubChem CID 114030951) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid.
| Compound Name | 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 114030951 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2,3-dimethyl-5-(1,3-thiazole-5-carbonylamino)benzoic acid |
| SMILES | Cc1cc(NC(=O)c2cncs2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C13H12N2O3S/c1-7-3-9(4-10(8(7)2)13(17)18)15-12(16)11-5-14-6-19-11/h3-6H,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | TWBUNKFZWXIWOS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |