C11H14N2O5S — CID 114032024
(E)-3-[2-[[2-(2-methoxyethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 114032024) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is (E)-3-[2-[[2-(2-methoxyethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[2-(2-methoxyethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114032024 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (E)-3-[2-[[2-(2-methoxyethoxy)acetyl]amino]-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | COCCOCC(=O)Nc1ncc(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C11H14N2O5S/c1-17-4-5-18-7-9(14)13-11-12-6-8(19-11)2-3-10(15)16/h2-3,6H,4-5,7H2,1H3,(H,15,16)(H,12,13,14)/b3-2+ |
| InChIKey | WUXCURMTWPLMEJ-NSCUHMNNSA-N |
| XLogP | 0.84 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|