C11H15N3O3S — CID 94230878
(E)-3-[2-(butylcarbamoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 94230878) has the molecular formula C11H15N3O3S and a molecular weight of 269.33 g/mol. Its IUPAC name is (E)-3-[2-(butylcarbamoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(butylcarbamoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 94230878 |
| Molecular Formula | C11H15N3O3S |
| Molecular Weight | 269.33 g/mol |
| Exact Mass | 269.08 |
| IUPAC Name | (E)-3-[2-(butylcarbamoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CCCCNC(=O)Nc1ncc(/C=C/C(=O)O)s1 |
| InChI | InChI=1S/C11H15N3O3S/c1-2-3-6-12-10(17)14-11-13-7-8(18-11)4-5-9(15)16/h4-5,7H,2-3,6H2,1H3,(H,15,16)(H2,12,13,14,17)/b5-4+ |
| InChIKey | QIQXQEKZPWXWCS-SNAWJCMRSA-N |
| XLogP | 2.16 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|