C10H12N2O3S2 — CID 77021775
3-[2-(3-methylsulfanylpropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid (PubChem CID 77021775) has the molecular formula C10H12N2O3S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[2-(3-methylsulfanylpropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid.
| Compound Name | 3-[2-(3-methylsulfanylpropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77021775 |
| Molecular Formula | C10H12N2O3S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 3-[2-(3-methylsulfanylpropanoylamino)-1,3-thiazol-5-yl]prop-2-enoic acid |
| SMILES | CSCCC(=O)Nc1ncc(C=CC(=O)O)s1 |
| InChI | InChI=1S/C10H12N2O3S2/c1-16-5-4-8(13)12-10-11-6-7(17-10)2-3-9(14)15/h2-3,6H,4-5H2,1H3,(H,14,15)(H,11,12,13) |
| InChIKey | YIROLRBLTHYOFG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|