C8H10F4N4O — CID 114032446
N-[2-(4-aminopyrazol-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 114032446) has the molecular formula C8H10F4N4O and a molecular weight of 254.19 g/mol. Its IUPAC name is N-[2-(4-aminopyrazol-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 114032446 |
| Molecular Formula | C8H10F4N4O |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | N-[2-(4-aminopyrazol-1-yl)ethyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | Nc1cnn(CCNC(=O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C8H10F4N4O/c9-6(10)8(11,12)7(17)14-1-2-16-4-5(13)3-15-16/h3-4,6H,1-2,13H2,(H,14,17) |
| InChIKey | KRRBYIVBKHSPOJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|