C13H9F4NO — CID 114032456
3,3,4,4-tetrafluoro-1-quinolin-2-ylbutan-2-one (PubChem CID 114032456) has the molecular formula C13H9F4NO and a molecular weight of 271.21 g/mol. Its IUPAC name is 3,3,4,4-tetrafluoro-1-quinolin-2-ylbutan-2-one.
| Compound Name | 3,3,4,4-tetrafluoro-1-quinolin-2-ylbutan-2-one |
|---|---|
| PubChem CID | 114032456 |
| Molecular Formula | C13H9F4NO |
| Molecular Weight | 271.21 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3,3,4,4-tetrafluoro-1-quinolin-2-ylbutan-2-one |
| SMILES | O=C(Cc1ccc2ccccc2n1)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H9F4NO/c14-12(15)13(16,17)11(19)7-9-6-5-8-3-1-2-4-10(8)18-9/h1-6,12H,7H2 |
| InChIKey | PIEQKXSKZAGGRE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|