C14H13F3N2O — CID 116593146
3-amino-4,4,4-trifluoro-3-methyl-1-quinolin-2-ylbutan-2-one (PubChem CID 116593146) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is 3-amino-4,4,4-trifluoro-3-methyl-1-quinolin-2-ylbutan-2-one.
| Compound Name | 3-amino-4,4,4-trifluoro-3-methyl-1-quinolin-2-ylbutan-2-one |
|---|---|
| PubChem CID | 116593146 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 3-amino-4,4,4-trifluoro-3-methyl-1-quinolin-2-ylbutan-2-one |
| SMILES | CC(N)(C(=O)Cc1ccc2ccccc2n1)C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O/c1-13(18,14(15,16)17)12(20)8-10-7-6-9-4-2-3-5-11(9)19-10/h2-7H,8,18H2,1H3 |
| InChIKey | BENCUJOCERWNGL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |