C13H19BrINO — CID 114033016
1-(5-bromo-2-iodophenyl)-N-ethyl-4-methoxybutan-1-amine (PubChem CID 114033016) has the molecular formula C13H19BrINO and a molecular weight of 412.11 g/mol. Its IUPAC name is 1-(5-bromo-2-iodophenyl)-N-ethyl-4-methoxybutan-1-amine.
| Compound Name | 1-(5-bromo-2-iodophenyl)-N-ethyl-4-methoxybutan-1-amine |
|---|---|
| PubChem CID | 114033016 |
| Molecular Formula | C13H19BrINO |
| Molecular Weight | 412.11 g/mol |
| Exact Mass | 410.97 |
| IUPAC Name | 1-(5-bromo-2-iodophenyl)-N-ethyl-4-methoxybutan-1-amine |
| SMILES | CCNC(CCCOC)c1cc(Br)ccc1I |
| InChI | InChI=1S/C13H19BrINO/c1-3-16-13(5-4-8-17-2)11-9-10(14)6-7-12(11)15/h6-7,9,13,16H,3-5,8H2,1-2H3 |
| InChIKey | LAKZQXAWRUCAPS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.11 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|