About 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate
2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate (PubChem CID 114035402) has the molecular formula C12H15ClFNO3
and a molecular weight of 275.71 g/mol. Its IUPAC name is 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate.
Molecular Properties
| Compound Name | 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate |
| PubChem CID | 114035402 |
| Molecular Formula | C12H15ClFNO3 |
| Molecular Weight | 275.71 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate |
| SMILES | CCCCOCCOC(=O)c1cc(F)cnc1Cl |
| InChI | InChI=1S/C12H15ClFNO3/c1-2-3-4-17-5-6-18-12(16)10-7-9(14)8-15-11(10)13/h7-8H,2-6H2,1H3 |
| InChIKey | FIKRIJGONOGUNW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.71 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate?
The IUPAC name of 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate (CID 114035402) is 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate.
What is the SMILES notation for 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate?
The canonical SMILES for 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate is CCCCOCCOC(=O)c1cc(F)cnc1Cl.
What is the InChIKey of 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate?
The InChIKey is FIKRIJGONOGUNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClFNO3/c1-2-3-4-17-5-6-18-12(16)10-7-9(14)8-15-11(10)13/h7-8H,2-6H2,1H3.
What are the key properties of 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate?
2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate has a molecular weight of 275.71 g/mol, XLogP of 2.85, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethyl 2-chloro-5-fluoropyridine-3-carboxylate is sourced from PubChem (CID 114035402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).