C9H7F5N2OS — CID 114038201
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 114038201) has the molecular formula C9H7F5N2OS and a molecular weight of 286.23 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 114038201 |
| Molecular Formula | C9H7F5N2OS |
| Molecular Weight | 286.23 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C(Nc1nc(C2CC2)cs1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F5N2OS/c10-8(11,9(12,13)14)6(17)16-7-15-5(3-18-7)4-1-2-4/h3-4H,1-2H2,(H,15,16,17) |
| InChIKey | MYUIRJHXHAOXII-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|