C10H12F5NO2 — CID 114038258
2,2,3,3,3-pentafluoro-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one (PubChem CID 114038258) has the molecular formula C10H12F5NO2 and a molecular weight of 273.20 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 114038258 |
| Molecular Formula | C10H12F5NO2 |
| Molecular Weight | 273.20 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-1-one |
| SMILES | COCC1=CCN(C(=O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H12F5NO2/c1-18-6-7-2-4-16(5-3-7)8(17)9(11,12)10(13,14)15/h2H,3-6H2,1H3 |
| InChIKey | QDDYKDXJRIZOHM-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.20 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|