C8H13NO2 — CID 114413627
4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbaldehyde (PubChem CID 114413627) has the molecular formula C8H13NO2 and a molecular weight of 155.20 g/mol. Its IUPAC name is 4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbaldehyde.
| Compound Name | 4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbaldehyde |
|---|---|
| PubChem CID | 114413627 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | 4-(methoxymethyl)-3,6-dihydro-2H-pyridine-1-carbaldehyde |
| SMILES | COCC1=CCN(C=O)CC1 |
| InChI | InChI=1S/C8H13NO2/c1-11-6-8-2-4-9(7-10)5-3-8/h2,7H,3-6H2,1H3 |
| InChIKey | QCLWGLJJPAMVRB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|