C9H15NO2 — CID 114390138
1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone (PubChem CID 114390138) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone.
| Compound Name | 1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
|---|---|
| PubChem CID | 114390138 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 1-[4-(methoxymethyl)-3,6-dihydro-2H-pyridin-1-yl]ethanone |
| SMILES | COCC1=CCN(C(C)=O)CC1 |
| InChI | InChI=1S/C9H15NO2/c1-8(11)10-5-3-9(4-6-10)7-12-2/h3H,4-7H2,1-2H3 |
| InChIKey | ZZBIXUGIJXRFJN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|