C13H12N2O3 — CID 114038878
6-methyl-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxylic acid (PubChem CID 114038878) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxylic acid.
| Compound Name | 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114038878 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 6-methyl-4-oxo-1-(pyridin-4-ylmethyl)pyridine-3-carboxylic acid |
| SMILES | Cc1cc(=O)c(C(=O)O)cn1Cc1ccncc1 |
| InChI | InChI=1S/C13H12N2O3/c1-9-6-12(16)11(13(17)18)8-15(9)7-10-2-4-14-5-3-10/h2-6,8H,7H2,1H3,(H,17,18) |
| InChIKey | NNYICDYJRUEMQZ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |