C13H16N2O4 — CID 114040063
4-[(6-oxo-1H-pyridine-2-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 114040063) has the molecular formula C13H16N2O4 and a molecular weight of 264.28 g/mol. Its IUPAC name is 4-[(6-oxo-1H-pyridine-2-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(6-oxo-1H-pyridine-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 114040063 |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-[(6-oxo-1H-pyridine-2-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)CC1)c1cccc(=O)[nH]1 |
| InChI | InChI=1S/C13H16N2O4/c16-11-3-1-2-10(15-11)12(17)14-9-6-4-8(5-7-9)13(18)19/h1-3,8-9H,4-7H2,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | DLBUYKHCSPXSMJ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |