C13H16N2O5 — CID 60808542
4-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 60808542) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 4-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 60808542 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-[(2-hydroxy-6-oxo-1H-pyridine-4-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NC1CCC(C(=O)O)CC1)c1cc(O)[nH]c(=O)c1 |
| InChI | InChI=1S/C13H16N2O5/c16-10-5-8(6-11(17)15-10)12(18)14-9-3-1-7(2-4-9)13(19)20/h5-7,9H,1-4H2,(H,14,18)(H,19,20)(H2,15,16,17) |
| InChIKey | RAPORTWGLCKYHU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |