C13H19NO3 — CID 54921590
4-[[(2E,4E)-hexa-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 54921590) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 4-[[(2E,4E)-hexa-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2E,4E)-hexa-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 54921590 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 4-[[(2E,4E)-hexa-2,4-dienoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | C/C=C/C=C/C(=O)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C13H19NO3/c1-2-3-4-5-12(15)14-11-8-6-10(7-9-11)13(16)17/h2-5,10-11H,6-9H2,1H3,(H,14,15)(H,16,17)/b3-2+,5-4+ |
| InChIKey | COLQRAUEVXZVKT-MQQKCMAXSA-N |
| XLogP | 1.88 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|